C27H22N4O3 — CID 135444750
methyl 2-hydroxy-3-[N-[4-(1-methylimidazol-2-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate (PubChem CID 135444750) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[N-[4-(1-methylimidazol-2-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate.
| Compound Name | methyl 2-hydroxy-3-[N-[4-(1-methylimidazol-2-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 135444750 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | methyl 2-hydroxy-3-[N-[4-(1-methylimidazol-2-yl)phenyl]-C-phenylcarbonimidoyl]-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(/C(=N/c3ccc(-c4nccn4C)cc3)c3ccccc3)c(O)[nH]c2c1 |
| InChI | InChI=1S/C27H22N4O3/c1-31-15-14-28-25(31)18-8-11-20(12-9-18)29-24(17-6-4-3-5-7-17)23-21-13-10-19(27(33)34-2)16-22(21)30-26(23)32/h3-16,30,32H,1-2H3/b29-24+ |
| InChIKey | FGTKKOMKAGZKES-RMLRFSFXSA-N |
| XLogP | 5.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|