C34H28N4O3 — CID 135837798
ethyl 3-[N-[4-(1-benzylimidazol-2-yl)phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate (PubChem CID 135837798) has the molecular formula C34H28N4O3 and a molecular weight of 540.62 g/mol. Its IUPAC name is ethyl 3-[N-[4-(1-benzylimidazol-2-yl)phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate.
| Compound Name | ethyl 3-[N-[4-(1-benzylimidazol-2-yl)phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 135837798 |
| Molecular Formula | C34H28N4O3 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | ethyl 3-[N-[4-(1-benzylimidazol-2-yl)phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(/C(=N/c3ccc(-c4nccn4Cc4ccccc4)cc3)c3ccccc3)c(O)[nH]c2c1 |
| InChI | InChI=1S/C34H28N4O3/c1-2-41-34(40)26-15-18-28-29(21-26)37-33(39)30(28)31(24-11-7-4-8-12-24)36-27-16-13-25(14-17-27)32-35-19-20-38(32)22-23-9-5-3-6-10-23/h3-21,37,39H,2,22H2,1H3/b36-31+ |
| InChIKey | HKNYMHYQBHSREP-XKMRCYARSA-N |
| XLogP | 7.13 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|