C31H27N3O3 — CID 135837985
ethyl 3-[N-[4-(anilinomethyl)phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate (PubChem CID 135837985) has the molecular formula C31H27N3O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is ethyl 3-[N-[4-(anilinomethyl)phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate.
| Compound Name | ethyl 3-[N-[4-(anilinomethyl)phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 135837985 |
| Molecular Formula | C31H27N3O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | ethyl 3-[N-[4-(anilinomethyl)phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(/C(=N/c3ccc(CNc4ccccc4)cc3)c3ccccc3)c(O)[nH]c2c1 |
| InChI | InChI=1S/C31H27N3O3/c1-2-37-31(36)23-15-18-26-27(19-23)34-30(35)28(26)29(22-9-5-3-6-10-22)33-25-16-13-21(14-17-25)20-32-24-11-7-4-8-12-24/h3-19,32,34-35H,2,20H2,1H3/b33-29+ |
| InChIKey | QQZUXLAJLVVJFA-XPXRSFDGSA-N |
| XLogP | 6.83 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|