C29H31N5O4 — CID 135837684
ethyl 3-[N-[3-amino-4-[[2-(dimethylamino)acetyl]-methylamino]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate (PubChem CID 135837684) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is ethyl 3-[N-[3-amino-4-[[2-(dimethylamino)acetyl]-methylamino]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate.
| Compound Name | ethyl 3-[N-[3-amino-4-[[2-(dimethylamino)acetyl]-methylamino]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 135837684 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | ethyl 3-[N-[3-amino-4-[[2-(dimethylamino)acetyl]-methylamino]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(/C(=N/c3ccc(N(C)C(=O)CN(C)C)c(N)c3)c3ccccc3)c(O)[nH]c2c1 |
| InChI | InChI=1S/C29H31N5O4/c1-5-38-29(37)19-11-13-21-23(15-19)32-28(36)26(21)27(18-9-7-6-8-10-18)31-20-12-14-24(22(30)16-20)34(4)25(35)17-33(2)3/h6-16,32,36H,5,17,30H2,1-4H3/b31-27+ |
| InChIKey | COWYIDCGNISBES-TVKQRKNISA-N |
| XLogP | 4.33 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|