C34H33N3O3 — CID 135838016
ethyl 3-[N-[4-[[benzyl(ethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate (PubChem CID 135838016) has the molecular formula C34H33N3O3 and a molecular weight of 531.66 g/mol. Its IUPAC name is ethyl 3-[N-[4-[[benzyl(ethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate.
| Compound Name | ethyl 3-[N-[4-[[benzyl(ethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 135838016 |
| Molecular Formula | C34H33N3O3 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | ethyl 3-[N-[4-[[benzyl(ethyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-2-hydroxy-1H-indole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(/C(=N/c3ccc(CN(CC)Cc4ccccc4)cc3)c3ccccc3)c(O)[nH]c2c1 |
| InChI | InChI=1S/C34H33N3O3/c1-3-37(22-24-11-7-5-8-12-24)23-25-15-18-28(19-16-25)35-32(26-13-9-6-10-14-26)31-29-20-17-27(34(39)40-4-2)21-30(29)36-33(31)38/h5-21,36,38H,3-4,22-23H2,1-2H3/b35-32+ |
| InChIKey | KNHNHGWUVLGTGC-LVYIWIAJSA-N |
| XLogP | 7.24 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|