C32H31N3O3 — CID 135543830
3-[N-[4-[[benzyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1H-indol-2-ol (PubChem CID 135543830) has the molecular formula C32H31N3O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is 3-[N-[4-[[benzyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1H-indol-2-ol.
| Compound Name | 3-[N-[4-[[benzyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1H-indol-2-ol |
|---|---|
| PubChem CID | 135543830 |
| Molecular Formula | C32H31N3O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 3-[N-[4-[[benzyl(methyl)amino]methyl]phenyl]-C-phenylcarbonimidoyl]-5,6-dimethoxy-1H-indol-2-ol |
| SMILES | COc1cc2[nH]c(O)c(/C(=N/c3ccc(CN(C)Cc4ccccc4)cc3)c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C32H31N3O3/c1-35(20-22-10-6-4-7-11-22)21-23-14-16-25(17-15-23)33-31(24-12-8-5-9-13-24)30-26-18-28(37-2)29(38-3)19-27(26)34-32(30)36/h4-19,34,36H,20-21H2,1-3H3/b33-31+ |
| InChIKey | ILAMREIWPDOTFK-QOSDPKFLSA-N |
| XLogP | 6.69 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|