C32H31N3O2 — CID 135622078
3-[N-[4-[3-[benzyl(methyl)amino]propoxy]phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol (PubChem CID 135622078) has the molecular formula C32H31N3O2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 3-[N-[4-[3-[benzyl(methyl)amino]propoxy]phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol.
| Compound Name | 3-[N-[4-[3-[benzyl(methyl)amino]propoxy]phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135622078 |
| Molecular Formula | C32H31N3O2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 3-[N-[4-[3-[benzyl(methyl)amino]propoxy]phenyl]-C-phenylcarbonimidoyl]-1H-indol-2-ol |
| SMILES | CN(CCCOc1ccc(/N=C(\c2ccccc2)c2c(O)[nH]c3ccccc23)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H31N3O2/c1-35(23-24-11-4-2-5-12-24)21-10-22-37-27-19-17-26(18-20-27)33-31(25-13-6-3-7-14-25)30-28-15-8-9-16-29(28)34-32(30)36/h2-9,11-20,34,36H,10,21-23H2,1H3/b33-31+ |
| InChIKey | YARCMTHJEUMZQV-QOSDPKFLSA-N |
| XLogP | 6.94 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|