C24H22N4O2 — CID 135423060
1-ethyl-3-[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]urea (PubChem CID 135423060) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-ethyl-3-[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]urea.
| Compound Name | 1-ethyl-3-[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]urea |
|---|---|
| PubChem CID | 135423060 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-ethyl-3-[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]urea |
| SMILES | CCNC(=O)Nc1ccc(/N=C(\c2ccccc2)c2c(O)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C24H22N4O2/c1-2-25-24(30)27-18-14-12-17(13-15-18)26-22(16-8-4-3-5-9-16)21-19-10-6-7-11-20(19)28-23(21)29/h3-15,28-29H,2H2,1H3,(H2,25,27,30)/b26-22+ |
| InChIKey | YYLIHWPPZQPMKP-XTCLZLMSSA-N |
| XLogP | 5.18 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|