C25H23N3O5S — CID 135621997
ethyl 2-[[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]sulfonylamino]acetate (PubChem CID 135621997) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is ethyl 2-[[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]sulfonylamino]acetate.
| Compound Name | ethyl 2-[[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 135621997 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | ethyl 2-[[4-[[(2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]sulfonylamino]acetate |
| SMILES | CCOC(=O)CNS(=O)(=O)c1ccc(/N=C(\c2ccccc2)c2c(O)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H23N3O5S/c1-2-33-22(29)16-26-34(31,32)19-14-12-18(13-15-19)27-24(17-8-4-3-5-9-17)23-20-10-6-7-11-21(20)28-25(23)30/h3-15,26,28,30H,2,16H2,1H3/b27-24+ |
| InChIKey | DTUALSPKRDMQGP-SOYKGTTHSA-N |
| XLogP | 3.88 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|