C31H28N4O4S — CID 135696669
N-[4-[[[5-(benzenesulfonamido)-2-hydroxy-1H-indol-3-yl]-phenylmethylidene]amino]phenyl]-N-methylpropanamide (PubChem CID 135696669) has the molecular formula C31H28N4O4S and a molecular weight of 552.66 g/mol. Its IUPAC name is N-[4-[[[5-(benzenesulfonamido)-2-hydroxy-1H-indol-3-yl]-phenylmethylidene]amino]phenyl]-N-methylpropanamide.
| Compound Name | N-[4-[[[5-(benzenesulfonamido)-2-hydroxy-1H-indol-3-yl]-phenylmethylidene]amino]phenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 135696669 |
| Molecular Formula | C31H28N4O4S |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | N-[4-[[[5-(benzenesulfonamido)-2-hydroxy-1H-indol-3-yl]-phenylmethylidene]amino]phenyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)c1ccc(/N=C(\c2ccccc2)c2c(O)[nH]c3ccc(NS(=O)(=O)c4ccccc4)cc23)cc1 |
| InChI | InChI=1S/C31H28N4O4S/c1-3-28(36)35(2)24-17-14-22(15-18-24)32-30(21-10-6-4-7-11-21)29-26-20-23(16-19-27(26)33-31(29)37)34-40(38,39)25-12-8-5-9-13-25/h4-20,33-34,37H,3H2,1-2H3/b32-30+ |
| InChIKey | FEMISPAMXKLJSH-NHQGMKOOSA-N |
| XLogP | 6.22 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|