C27H28N4O4 — CID 135585676
3-amino-N-[4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]-N-methylpropanamide (PubChem CID 135585676) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 3-amino-N-[4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]-N-methylpropanamide.
| Compound Name | 3-amino-N-[4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 135585676 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 3-amino-N-[4-[[(2-hydroxy-5,6-dimethoxy-1H-indol-3-yl)-phenylmethylidene]amino]phenyl]-N-methylpropanamide |
| SMILES | COc1cc2[nH]c(O)c(/C(=N/c3ccc(N(C)C(=O)CCN)cc3)c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C27H28N4O4/c1-31(24(32)13-14-28)19-11-9-18(10-12-19)29-26(17-7-5-4-6-8-17)25-20-15-22(34-2)23(35-3)16-21(20)30-27(25)33/h4-12,15-16,30,33H,13-14,28H2,1-3H3/b29-26+ |
| InChIKey | KBYJSCXOBDOOPI-PBBVDAKRSA-N |
| XLogP | 4.37 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|