C31H34N4O5 — CID 135585858
2-[N-acetyl-4-[[(5,6-diethoxy-2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]anilino]-N,N-dimethylacetamide (PubChem CID 135585858) has the molecular formula C31H34N4O5 and a molecular weight of 542.64 g/mol. Its IUPAC name is 2-[N-acetyl-4-[[(5,6-diethoxy-2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]anilino]-N,N-dimethylacetamide.
| Compound Name | 2-[N-acetyl-4-[[(5,6-diethoxy-2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]anilino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 135585858 |
| Molecular Formula | C31H34N4O5 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 2-[N-acetyl-4-[[(5,6-diethoxy-2-hydroxy-1H-indol-3-yl)-phenylmethylidene]amino]anilino]-N,N-dimethylacetamide |
| SMILES | CCOc1cc2[nH]c(O)c(/C(=N/c3ccc(N(CC(=O)N(C)C)C(C)=O)cc3)c3ccccc3)c2cc1OCC |
| InChI | InChI=1S/C31H34N4O5/c1-6-39-26-17-24-25(18-27(26)40-7-2)33-31(38)29(24)30(21-11-9-8-10-12-21)32-22-13-15-23(16-14-22)35(20(3)36)19-28(37)34(4)5/h8-18,33,38H,6-7,19H2,1-5H3/b32-30+ |
| InChIKey | UNHZDTRXRDYJMM-NHQGMKOOSA-N |
| XLogP | 5.28 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|