C30H27N3O3 — CID 135585817
5,6-diethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1H-indol-2-ol (PubChem CID 135585817) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is 5,6-diethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1H-indol-2-ol.
| Compound Name | 5,6-diethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135585817 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 5,6-diethoxy-3-[C-phenyl-N-(4-pyridin-2-ylphenyl)carbonimidoyl]-1H-indol-2-ol |
| SMILES | CCOc1cc2[nH]c(O)c(/C(=N/c3ccc(-c4ccccn4)cc3)c3ccccc3)c2cc1OCC |
| InChI | InChI=1S/C30H27N3O3/c1-3-35-26-18-23-25(19-27(26)36-4-2)33-30(34)28(23)29(21-10-6-5-7-11-21)32-22-15-13-20(14-16-22)24-12-8-9-17-31-24/h5-19,33-34H,3-4H2,1-2H3/b32-29+ |
| InChIKey | ONDQCAMHTDIOJA-UUDCSCGESA-N |
| XLogP | 6.90 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|