C60H42N6 — CID 140904704
N-[3,5-bis[[phenyl-(4-pyridin-2-ylphenyl)methylidene]amino]phenyl]-1-phenyl-1-(4-pyridin-2-ylphenyl)methanimine (PubChem CID 140904704) has the molecular formula C60H42N6 and a molecular weight of 847.04 g/mol. Its IUPAC name is N-[3,5-bis[[phenyl-(4-pyridin-2-ylphenyl)methylidene]amino]phenyl]-1-phenyl-1-(4-pyridin-2-ylphenyl)methanimine.
| Compound Name | N-[3,5-bis[[phenyl-(4-pyridin-2-ylphenyl)methylidene]amino]phenyl]-1-phenyl-1-(4-pyridin-2-ylphenyl)methanimine |
|---|---|
| PubChem CID | 140904704 |
| Molecular Formula | C60H42N6 |
| Molecular Weight | 847.04 g/mol |
| Exact Mass | 846.35 |
| IUPAC Name | N-[3,5-bis[[phenyl-(4-pyridin-2-ylphenyl)methylidene]amino]phenyl]-1-phenyl-1-(4-pyridin-2-ylphenyl)methanimine |
| SMILES | c1ccc(/C(=N\c2cc(/N=C(\c3ccccc3)c3ccc(-c4ccccn4)cc3)cc(/N=C(\c3ccccc3)c3ccc(-c4ccccn4)cc3)c2)c2ccc(-c3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C60H42N6/c1-4-16-46(17-5-1)58(49-31-25-43(26-32-49)55-22-10-13-37-61-55)64-52-40-53(65-59(47-18-6-2-7-19-47)50-33-27-44(28-34-50)56-23-11-14-38-62-56)42-54(41-52)66-60(48-20-8-3-9-21-48)51-35-29-45(30-36-51)57-24-12-15-39-63-57/h1-42H/b64-58+,65-59+,66-60+ |
| InChIKey | FXQRGXMIXCSVQA-LJAYWLRASA-N |
| XLogP | 14.38 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.04 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|