C21H19N — CID 11033428
N-(3,5-dimethylphenyl)-1,1-diphenylmethanimine (PubChem CID 11033428) has the molecular formula C21H19N and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-1,1-diphenylmethanimine.
| Compound Name | N-(3,5-dimethylphenyl)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 11033428 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-(3,5-dimethylphenyl)-1,1-diphenylmethanimine |
| SMILES | Cc1cc(C)cc(N=C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H19N/c1-16-13-17(2)15-20(14-16)22-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-15H,1-2H3 |
| InChIKey | OVOKGMSFXVWRHU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|