C19H15NO2 — CID 175353708
4-(benzhydrylideneamino)benzene-1,2-diol (PubChem CID 175353708) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-(benzhydrylideneamino)benzene-1,2-diol.
| Compound Name | 4-(benzhydrylideneamino)benzene-1,2-diol |
|---|---|
| PubChem CID | 175353708 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-(benzhydrylideneamino)benzene-1,2-diol |
| SMILES | Oc1ccc(N=C(c2ccccc2)c2ccccc2)cc1O |
| InChI | InChI=1S/C19H15NO2/c21-17-12-11-16(13-18(17)22)20-19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,21-22H |
| InChIKey | MSQGUJCLMDMYJI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|