About 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one
10-(3,4-dihydroxyphenyl)iminoanthracen-9-one (PubChem CID 135457303) has the molecular formula C20H13NO3
and a molecular weight of 315.33 g/mol. Its IUPAC name is 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one.
Molecular Properties
| Compound Name | 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one |
| PubChem CID | 135457303 |
| Molecular Formula | C20H13NO3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one |
| SMILES | O=C1c2ccccc2C(=Nc2ccc(O)c(O)c2)c2ccccc21 |
| InChI | InChI=1S/C20H13NO3/c22-17-10-9-12(11-18(17)23)21-19-13-5-1-3-7-15(13)20(24)16-8-4-2-6-14(16)19/h1-11,22-23H |
| InChIKey | DPIUMEFHAQQYLR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one?
The IUPAC name of 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one (CID 135457303) is 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one.
What is the SMILES notation for 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one?
The canonical SMILES for 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one is O=C1c2ccccc2C(=Nc2ccc(O)c(O)c2)c2ccccc21.
What is the InChIKey of 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one?
The InChIKey is DPIUMEFHAQQYLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13NO3/c22-17-10-9-12(11-18(17)23)21-19-13-5-1-3-7-15(13)20(24)16-8-4-2-6-14(16)19/h1-11,22-23H.
What are the key properties of 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one?
10-(3,4-dihydroxyphenyl)iminoanthracen-9-one has a molecular weight of 315.33 g/mol, XLogP of 3.81, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3,4-dihydroxyphenyl)iminoanthracen-9-one is sourced from PubChem (CID 135457303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).