About anthracene-9,10-dione;benzene-1,4-diol
anthracene-9,10-dione;benzene-1,4-diol (PubChem CID 70474233) has the molecular formula C20H14O4
and a molecular weight of 318.33 g/mol. Its IUPAC name is anthracene-9,10-dione;benzene-1,4-diol.
Molecular Properties
| Compound Name | anthracene-9,10-dione;benzene-1,4-diol |
| PubChem CID | 70474233 |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | anthracene-9,10-dione;benzene-1,4-diol |
| SMILES | O=C1c2ccccc2C(=O)c2ccccc21.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C14H8O2.C6H6O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;7-5-1-2-6(8)4-3-5/h1-8H;1-4,7-8H |
| InChIKey | IXYBFZWIFLLCHQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-dione;benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-dione;benzene-1,4-diol?
The IUPAC name of anthracene-9,10-dione;benzene-1,4-diol (CID 70474233) is anthracene-9,10-dione;benzene-1,4-diol.
What is the SMILES notation for anthracene-9,10-dione;benzene-1,4-diol?
The canonical SMILES for anthracene-9,10-dione;benzene-1,4-diol is O=C1c2ccccc2C(=O)c2ccccc21.Oc1ccc(O)cc1.
What is the InChIKey of anthracene-9,10-dione;benzene-1,4-diol?
The InChIKey is IXYBFZWIFLLCHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2.C6H6O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;7-5-1-2-6(8)4-3-5/h1-8H;1-4,7-8H.
What are the key properties of anthracene-9,10-dione;benzene-1,4-diol?
anthracene-9,10-dione;benzene-1,4-diol has a molecular weight of 318.33 g/mol, XLogP of 3.56, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-dione;benzene-1,4-diol is sourced from PubChem (CID 70474233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).