C25H28O4 — CID 90695266
anthracene-9,10-dione;ethane;4-methoxyphenol (PubChem CID 90695266) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is anthracene-9,10-dione;ethane;4-methoxyphenol.
| Compound Name | anthracene-9,10-dione;ethane;4-methoxyphenol |
|---|---|
| PubChem CID | 90695266 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | anthracene-9,10-dione;ethane;4-methoxyphenol |
| SMILES | CC.CC.COc1ccc(O)cc1.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H8O2.C7H8O2.2C2H6/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-9-7-4-2-6(8)3-5-7;2*1-2/h1-8H;2-5,8H,1H3;2*1-2H3 |
| InChIKey | NJNKCXKZFOQHKX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|