C23H17NO5S — CID 15958441
2-(4-hydroxyphenyl)sulfinyl-3-(4-methoxyanilino)naphthalene-1,4-dione (PubChem CID 15958441) has the molecular formula C23H17NO5S and a molecular weight of 419.46 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)sulfinyl-3-(4-methoxyanilino)naphthalene-1,4-dione.
| Compound Name | 2-(4-hydroxyphenyl)sulfinyl-3-(4-methoxyanilino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 15958441 |
| Molecular Formula | C23H17NO5S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-(4-hydroxyphenyl)sulfinyl-3-(4-methoxyanilino)naphthalene-1,4-dione |
| SMILES | COc1ccc(NC2=C(S(=O)c3ccc(O)cc3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H17NO5S/c1-29-16-10-6-14(7-11-16)24-20-21(26)18-4-2-3-5-19(18)22(27)23(20)30(28)17-12-8-15(25)9-13-17/h2-13,24-25H,1H3 |
| InChIKey | JXNJKOOXOYHVIE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|