C23H17ClN2O5S — CID 138608771
N-[4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]phenyl]-4-methoxybenzenesulfonamide (PubChem CID 138608771) has the molecular formula C23H17ClN2O5S and a molecular weight of 468.92 g/mol. Its IUPAC name is N-[4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]phenyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]phenyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 138608771 |
| Molecular Formula | C23H17ClN2O5S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | N-[4-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]phenyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(NC3=C(Cl)C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C23H17ClN2O5S/c1-31-16-10-12-17(13-11-16)32(29,30)26-15-8-6-14(7-9-15)25-21-20(24)22(27)18-4-2-3-5-19(18)23(21)28/h2-13,25-26H,1H3 |
| InChIKey | IMOYYNMTOJNQQO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|