C18H14ClNO4 — CID 129009526
2-chloro-3-(2,4-dimethoxyanilino)naphthalene-1,4-dione (PubChem CID 129009526) has the molecular formula C18H14ClNO4 and a molecular weight of 343.77 g/mol. Its IUPAC name is 2-chloro-3-(2,4-dimethoxyanilino)naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-(2,4-dimethoxyanilino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 129009526 |
| Molecular Formula | C18H14ClNO4 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 2-chloro-3-(2,4-dimethoxyanilino)naphthalene-1,4-dione |
| SMILES | COc1ccc(NC2=C(Cl)C(=O)c3ccccc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C18H14ClNO4/c1-23-10-7-8-13(14(9-10)24-2)20-16-15(19)17(21)11-5-3-4-6-12(11)18(16)22/h3-9,20H,1-2H3 |
| InChIKey | DRKXCOVUFTYGCC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|