C18H13Cl3N2O4 — CID 1180662
3-chloro-1-(3,4-dichlorophenyl)-4-(2,4-dimethoxyanilino)pyrrole-2,5-dione (PubChem CID 1180662) has the molecular formula C18H13Cl3N2O4 and a molecular weight of 427.67 g/mol. Its IUPAC name is 3-chloro-1-(3,4-dichlorophenyl)-4-(2,4-dimethoxyanilino)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(3,4-dichlorophenyl)-4-(2,4-dimethoxyanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1180662 |
| Molecular Formula | C18H13Cl3N2O4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | 3-chloro-1-(3,4-dichlorophenyl)-4-(2,4-dimethoxyanilino)pyrrole-2,5-dione |
| SMILES | COc1ccc(NC2=C(Cl)C(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C18H13Cl3N2O4/c1-26-10-4-6-13(14(8-10)27-2)22-16-15(21)17(24)23(18(16)25)9-3-5-11(19)12(20)7-9/h3-8,22H,1-2H3 |
| InChIKey | BMGAHVYMACSPFF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|