C19H16Cl2N2O2 — CID 1181998
3-chloro-1-(3-chloro-4-methylphenyl)-4-(2,3-dimethylanilino)pyrrole-2,5-dione (PubChem CID 1181998) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is 3-chloro-1-(3-chloro-4-methylphenyl)-4-(2,3-dimethylanilino)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-(3-chloro-4-methylphenyl)-4-(2,3-dimethylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 1181998 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 3-chloro-1-(3-chloro-4-methylphenyl)-4-(2,3-dimethylanilino)pyrrole-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C(Cl)=C(Nc3cccc(C)c3C)C2=O)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-10-5-4-6-15(12(10)3)22-17-16(21)18(24)23(19(17)25)13-8-7-11(2)14(20)9-13/h4-9,22H,1-3H3 |
| InChIKey | YYRDQERBQFLGQV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|