C26H19Cl2N3O5 — CID 1408502
2-[[2-[4-[[4-chloro-1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]acetyl]amino]benzoic acid (PubChem CID 1408502) has the molecular formula C26H19Cl2N3O5 and a molecular weight of 524.36 g/mol. Its IUPAC name is 2-[[2-[4-[[4-chloro-1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-[[4-chloro-1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 1408502 |
| Molecular Formula | C26H19Cl2N3O5 |
| Molecular Weight | 524.36 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 2-[[2-[4-[[4-chloro-1-(3-chloro-4-methylphenyl)-2,5-dioxopyrrol-3-yl]amino]phenyl]acetyl]amino]benzoic acid |
| SMILES | Cc1ccc(N2C(=O)C(Cl)=C(Nc3ccc(CC(=O)Nc4ccccc4C(=O)O)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C26H19Cl2N3O5/c1-14-6-11-17(13-19(14)27)31-24(33)22(28)23(25(31)34)29-16-9-7-15(8-10-16)12-21(32)30-20-5-3-2-4-18(20)26(35)36/h2-11,13,29H,12H2,1H3,(H,30,32)(H,35,36) |
| InChIKey | NHCQQAQUYJXQSD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|