C26H18ClF3N4O5 — CID 1408356
2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]-N-(4-methyl-3-nitrophenyl)acetamide (PubChem CID 1408356) has the molecular formula C26H18ClF3N4O5 and a molecular weight of 558.90 g/mol. Its IUPAC name is 2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]-N-(4-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]-N-(4-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1408356 |
| Molecular Formula | C26H18ClF3N4O5 |
| Molecular Weight | 558.90 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | 2-[4-[[4-chloro-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]pyrrol-3-yl]amino]phenyl]-N-(4-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2ccc(NC3=C(Cl)C(=O)N(c4cccc(C(F)(F)F)c4)C3=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H18ClF3N4O5/c1-14-5-8-18(13-20(14)34(38)39)31-21(35)11-15-6-9-17(10-7-15)32-23-22(27)24(36)33(25(23)37)19-4-2-3-16(12-19)26(28,29)30/h2-10,12-13,32H,11H2,1H3,(H,31,35) |
| InChIKey | ZPKNNWXSZRPALS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.90 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|