C18H11Cl2F3N2O2 — CID 155806126
3-chloro-4-[(4-chlorophenyl)methylamino]-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione (PubChem CID 155806126) has the molecular formula C18H11Cl2F3N2O2 and a molecular weight of 415.20 g/mol. Its IUPAC name is 3-chloro-4-[(4-chlorophenyl)methylamino]-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3-chloro-4-[(4-chlorophenyl)methylamino]-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 155806126 |
| Molecular Formula | C18H11Cl2F3N2O2 |
| Molecular Weight | 415.20 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 3-chloro-4-[(4-chlorophenyl)methylamino]-1-[3-(trifluoromethyl)phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C(Cl)=C(NCc2ccc(Cl)cc2)C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H11Cl2F3N2O2/c19-12-6-4-10(5-7-12)9-24-15-14(20)16(26)25(17(15)27)13-3-1-2-11(8-13)18(21,22)23/h1-8,24H,9H2 |
| InChIKey | OZSALAZVQAHPBT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.20 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|