C18H10ClF3N2O3 — CID 6578395
(6aR)-3-(4-chlorophenyl)-5-[3-(trifluoromethyl)phenyl]-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 6578395) has the molecular formula C18H10ClF3N2O3 and a molecular weight of 394.74 g/mol. Its IUPAC name is (6aR)-3-(4-chlorophenyl)-5-[3-(trifluoromethyl)phenyl]-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (6aR)-3-(4-chlorophenyl)-5-[3-(trifluoromethyl)phenyl]-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 6578395 |
| Molecular Formula | C18H10ClF3N2O3 |
| Molecular Weight | 394.74 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | (6aR)-3-(4-chlorophenyl)-5-[3-(trifluoromethyl)phenyl]-2,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1C2=C(c3ccc(Cl)cc3)NO[C@H]2C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H10ClF3N2O3/c19-11-6-4-9(5-7-11)14-13-15(27-23-14)17(26)24(16(13)25)12-3-1-2-10(8-12)18(20,21)22/h1-8,15,23H/t15-/m1/s1 |
| InChIKey | FRBFUFFFFNQHTH-OAHLLOKOSA-N |
| XLogP | 3.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|