C40H24Cl2F3NO3 — CID 99651282
(1R,2R,6S,7R)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 99651282) has the molecular formula C40H24Cl2F3NO3 and a molecular weight of 694.54 g/mol. Its IUPAC name is (1R,2R,6S,7R)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2R,6S,7R)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 99651282 |
| Molecular Formula | C40H24Cl2F3NO3 |
| Molecular Weight | 694.54 g/mol |
| Exact Mass | 693.11 |
| IUPAC Name | (1R,2R,6S,7R)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-[3-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1cccc(C(F)(F)F)c1)[C@]1(c3ccc(Cl)cc3)C(=O)[C@]2(c2ccc(Cl)cc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C40H24Cl2F3NO3/c41-28-18-14-25(15-19-28)38-31(23-8-3-1-4-9-23)32(24-10-5-2-6-11-24)39(37(38)49,26-16-20-29(42)21-17-26)34-33(38)35(47)46(36(34)48)30-13-7-12-27(22-30)40(43,44)45/h1-22,33-34H/t33-,34+,38-,39-/m1/s1 |
| InChIKey | NWXFRLPDQSJNPH-UDKDVIIMSA-N |
| XLogP | 9.20 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.54 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|