C40H25Cl2NO5 — CID 99651314
3-[(1R,2R,6S,7R)-1,7-bis(4-chlorophenyl)-3,5,10-trioxo-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid (PubChem CID 99651314) has the molecular formula C40H25Cl2NO5 and a molecular weight of 670.55 g/mol. Its IUPAC name is 3-[(1R,2R,6S,7R)-1,7-bis(4-chlorophenyl)-3,5,10-trioxo-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid.
| Compound Name | 3-[(1R,2R,6S,7R)-1,7-bis(4-chlorophenyl)-3,5,10-trioxo-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid |
|---|---|
| PubChem CID | 99651314 |
| Molecular Formula | C40H25Cl2NO5 |
| Molecular Weight | 670.55 g/mol |
| Exact Mass | 669.11 |
| IUPAC Name | 3-[(1R,2R,6S,7R)-1,7-bis(4-chlorophenyl)-3,5,10-trioxo-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@]2(c4ccc(Cl)cc4)C(=O)[C@]3(c3ccc(Cl)cc3)C(c3ccccc3)=C2c2ccccc2)c1 |
| InChI | InChI=1S/C40H25Cl2NO5/c41-28-18-14-26(15-19-28)39-31(23-8-3-1-4-9-23)32(24-10-5-2-6-11-24)40(38(39)48,27-16-20-29(42)21-17-27)34-33(39)35(44)43(36(34)45)30-13-7-12-25(22-30)37(46)47/h1-22,33-34H,(H,46,47)/t33-,34+,39-,40-/m1/s1 |
| InChIKey | RJGDRQQXCKWHSY-GWOGJWAKSA-N |
| XLogP | 7.88 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.55 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|