C40H26ClNO5 — CID 99652149
2-chloro-5-[(1S,2S,6S,7R)-3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid (PubChem CID 99652149) has the molecular formula C40H26ClNO5 and a molecular weight of 636.10 g/mol. Its IUPAC name is 2-chloro-5-[(1S,2S,6S,7R)-3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid.
| Compound Name | 2-chloro-5-[(1S,2S,6S,7R)-3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid |
|---|---|
| PubChem CID | 99652149 |
| Molecular Formula | C40H26ClNO5 |
| Molecular Weight | 636.10 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | 2-chloro-5-[(1S,2S,6S,7R)-3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)[C@H]3[C@H](C2=O)[C@]2(c4ccccc4)C(=O)[C@@]3(c3ccccc3)C(c3ccccc3)=C2c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C40H26ClNO5/c41-30-22-21-28(23-29(30)37(45)46)42-35(43)33-34(36(42)44)40(27-19-11-4-12-20-27)32(25-15-7-2-8-16-25)31(24-13-5-1-6-14-24)39(33,38(40)47)26-17-9-3-10-18-26/h1-23,33-34H,(H,45,46)/t33-,34-,39-,40+/m1/s1 |
| InChIKey | VVXWAAXCUFKJGZ-VWAYNFHMSA-N |
| XLogP | 7.23 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.10 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|