C42H32ClNO3 — CID 124600492
(1R,2S,6R,7R)-4-(3-chloro-4-methylphenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 124600492) has the molecular formula C42H32ClNO3 and a molecular weight of 634.17 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-(3-chloro-4-methylphenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2S,6R,7R)-4-(3-chloro-4-methylphenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 124600492 |
| Molecular Formula | C42H32ClNO3 |
| Molecular Weight | 634.17 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | (1R,2S,6R,7R)-4-(3-chloro-4-methylphenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | Cc1ccc(C2=C(c3ccc(C)cc3)[C@@]3(c4ccccc4)C(=O)[C@@]2(c2ccccc2)[C@@H]2C(=O)N(c4ccc(C)c(Cl)c4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C42H32ClNO3/c1-25-14-19-28(20-15-25)34-35(29-21-16-26(2)17-22-29)42(31-12-8-5-9-13-31)37-36(41(34,40(42)47)30-10-6-4-7-11-30)38(45)44(39(37)46)32-23-18-27(3)33(43)24-32/h4-24,36-37H,1-3H3/t36-,37+,41-,42-/m1/s1 |
| InChIKey | OLKZEIVCINJPNN-JXWCMEKSSA-N |
| XLogP | 8.45 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.17 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|