C41H30INO3 — CID 126010003
(1R,2R,6R,7R)-4-(4-iodophenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 126010003) has the molecular formula C41H30INO3 and a molecular weight of 711.60 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-(4-iodophenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2R,6R,7R)-4-(4-iodophenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 126010003 |
| Molecular Formula | C41H30INO3 |
| Molecular Weight | 711.60 g/mol |
| Exact Mass | 711.13 |
| IUPAC Name | (1R,2R,6R,7R)-4-(4-iodophenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | Cc1ccc(C2=C(c3ccc(C)cc3)[C@@]3(c4ccccc4)C(=O)[C@@]2(c2ccccc2)[C@@H]2C(=O)N(c4ccc(I)cc4)C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C41H30INO3/c1-25-13-17-27(18-14-25)33-34(28-19-15-26(2)16-20-28)41(30-11-7-4-8-12-30)36-35(40(33,39(41)46)29-9-5-3-6-10-29)37(44)43(38(36)45)32-23-21-31(42)22-24-32/h3-24,35-36H,1-2H3/t35-,36-,40+,41+/m0/s1 |
| InChIKey | ZXESWONRBNPPJM-BMPBIMJCSA-N |
| XLogP | 8.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.60 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|