C42H31NO5 — CID 46738452
ethyl 4-(3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate (PubChem CID 46738452) has the molecular formula C42H31NO5 and a molecular weight of 629.71 g/mol. Its IUPAC name is ethyl 4-(3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate.
| Compound Name | ethyl 4-(3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate |
|---|---|
| PubChem CID | 46738452 |
| Molecular Formula | C42H31NO5 |
| Molecular Weight | 629.71 g/mol |
| Exact Mass | 629.22 |
| IUPAC Name | ethyl 4-(3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C(C2=O)C2(c4ccccc4)C(=O)C3(c3ccccc3)C(c3ccccc3)=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C42H31NO5/c1-2-48-39(46)29-23-25-32(26-24-29)43-37(44)35-36(38(43)45)42(31-21-13-6-14-22-31)34(28-17-9-4-10-18-28)33(27-15-7-3-8-16-27)41(35,40(42)47)30-19-11-5-12-20-30/h3-26,35-36H,2H2,1H3 |
| InChIKey | NASHSPWQIZGWCV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.71 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|