C44H35NO5 — CID 124600499
ethyl 3-[(1S,2S,6S,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 124600499) has the molecular formula C44H35NO5 and a molecular weight of 657.77 g/mol. Its IUPAC name is ethyl 3-[(1S,2S,6S,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | ethyl 3-[(1S,2S,6S,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 124600499 |
| Molecular Formula | C44H35NO5 |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.25 |
| IUPAC Name | ethyl 3-[(1S,2S,6S,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2C(=O)[C@H]3[C@H](C2=O)[C@@]2(c4ccccc4)C(=O)[C@@]3(c3ccccc3)C(c3ccc(C)cc3)=C2c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C44H35NO5/c1-4-50-41(48)31-12-11-17-34(26-31)45-39(46)37-38(40(45)47)44(33-15-9-6-10-16-33)36(30-24-20-28(3)21-25-30)35(29-22-18-27(2)19-23-29)43(37,42(44)49)32-13-7-5-8-14-32/h5-26,37-38H,4H2,1-3H3/t37-,38-,43+,44+/m1/s1 |
| InChIKey | YVVNWYFABPTJSN-PRQNBZSOSA-N |
| XLogP | 7.67 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|