C43H33NO7 — CID 99651334
methyl 3-[(1R,2S,6S,7S)-8,9-bis(4-methoxyphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 99651334) has the molecular formula C43H33NO7 and a molecular weight of 675.74 g/mol. Its IUPAC name is methyl 3-[(1R,2S,6S,7S)-8,9-bis(4-methoxyphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | methyl 3-[(1R,2S,6S,7S)-8,9-bis(4-methoxyphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 99651334 |
| Molecular Formula | C43H33NO7 |
| Molecular Weight | 675.74 g/mol |
| Exact Mass | 675.23 |
| IUPAC Name | methyl 3-[(1R,2S,6S,7S)-8,9-bis(4-methoxyphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)[C@H]3[C@H](C2=O)[C@]2(c4ccccc4)C(=O)[C@@]3(c3ccccc3)C(c3ccc(OC)cc3)=C2c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C43H33NO7/c1-49-32-21-17-26(18-22-32)34-35(27-19-23-33(50-2)24-20-27)43(30-14-8-5-9-15-30)37-36(42(34,41(43)48)29-12-6-4-7-13-29)38(45)44(39(37)46)31-16-10-11-28(25-31)40(47)51-3/h4-25,36-37H,1-3H3/t36-,37-,42-,43+/m1/s1 |
| InChIKey | DFAAFGWZWIYMSY-CKFGNHPMSA-N |
| XLogP | 6.68 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.74 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|