C43H35NO5 — CID 99692486
(1R,2S,6S,7R)-4-(2,4-dimethylphenyl)-8,9-bis(4-methoxyphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 99692486) has the molecular formula C43H35NO5 and a molecular weight of 645.75 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-(2,4-dimethylphenyl)-8,9-bis(4-methoxyphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2S,6S,7R)-4-(2,4-dimethylphenyl)-8,9-bis(4-methoxyphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 99692486 |
| Molecular Formula | C43H35NO5 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.25 |
| IUPAC Name | (1R,2S,6S,7R)-4-(2,4-dimethylphenyl)-8,9-bis(4-methoxyphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)[C@@]3(c4ccccc4)C(=O)[C@@]2(c2ccccc2)[C@H]2C(=O)N(c4ccc(C)cc4C)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C43H35NO5/c1-26-15-24-34(27(2)25-26)44-39(45)37-38(40(44)46)43(31-13-9-6-10-14-31)36(29-18-22-33(49-4)23-19-29)35(28-16-20-32(48-3)21-17-28)42(37,41(43)47)30-11-7-5-8-12-30/h5-25,37-38H,1-4H3/t37-,38-,42-,43-/m1/s1 |
| InChIKey | CCGSOPKDMKKYLG-ULQRSLTBSA-N |
| XLogP | 7.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|