C42H33NO4 — CID 5036309
4-(2-methoxyphenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 5036309) has the molecular formula C42H33NO4 and a molecular weight of 615.73 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | 4-(2-methoxyphenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 5036309 |
| Molecular Formula | C42H33NO4 |
| Molecular Weight | 615.73 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | 4-(2-methoxyphenyl)-8,9-bis(4-methylphenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | COc1ccccc1N1C(=O)C2C(C1=O)C1(c3ccccc3)C(=O)C2(c2ccccc2)C(c2ccc(C)cc2)=C1c1ccc(C)cc1 |
| InChI | InChI=1S/C42H33NO4/c1-26-18-22-28(23-19-26)34-35(29-24-20-27(2)21-25-29)42(31-14-8-5-9-15-31)37-36(41(34,40(42)46)30-12-6-4-7-13-30)38(44)43(39(37)45)32-16-10-11-17-33(32)47-3/h4-25,36-37H,1-3H3 |
| InChIKey | NLQQKABALAHEHU-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.73 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|