C41H30N2O7 — CID 99721937
(1S,2S,6R,7S)-8,9-bis(4-methoxyphenyl)-4-(2-nitrophenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 99721937) has the molecular formula C41H30N2O7 and a molecular weight of 662.70 g/mol. Its IUPAC name is (1S,2S,6R,7S)-8,9-bis(4-methoxyphenyl)-4-(2-nitrophenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1S,2S,6R,7S)-8,9-bis(4-methoxyphenyl)-4-(2-nitrophenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 99721937 |
| Molecular Formula | C41H30N2O7 |
| Molecular Weight | 662.70 g/mol |
| Exact Mass | 662.21 |
| IUPAC Name | (1S,2S,6R,7S)-8,9-bis(4-methoxyphenyl)-4-(2-nitrophenyl)-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | COc1ccc(C2=C(c3ccc(OC)cc3)[C@]3(c4ccccc4)C(=O)[C@]2(c2ccccc2)[C@@H]2C(=O)N(c4ccccc4[N+](=O)[O-])C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C41H30N2O7/c1-49-29-21-17-25(18-22-29)33-34(26-19-23-30(50-2)24-20-26)41(28-13-7-4-8-14-28)36-35(40(33,39(41)46)27-11-5-3-6-12-27)37(44)42(38(36)45)31-15-9-10-16-32(31)43(47)48/h3-24,35-36H,1-2H3/t35-,36+,40-,41-/m0/s1 |
| InChIKey | BIIYWHLOULXKJD-QFMXGDCESA-N |
| XLogP | 6.80 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|