C39H25BrN2O5 — CID 99649088
(1R,2S,6R,7R)-4-(4-bromo-2-nitrophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 99649088) has the molecular formula C39H25BrN2O5 and a molecular weight of 681.54 g/mol. Its IUPAC name is (1R,2S,6R,7R)-4-(4-bromo-2-nitrophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2S,6R,7R)-4-(4-bromo-2-nitrophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 99649088 |
| Molecular Formula | C39H25BrN2O5 |
| Molecular Weight | 681.54 g/mol |
| Exact Mass | 680.09 |
| IUPAC Name | (1R,2S,6R,7R)-4-(4-bromo-2-nitrophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccc(Br)cc1[N+](=O)[O-])[C@]1(c3ccccc3)C(=O)[C@]2(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C39H25BrN2O5/c40-28-21-22-29(30(23-28)42(46)47)41-35(43)33-34(36(41)44)39(27-19-11-4-12-20-27)32(25-15-7-2-8-16-25)31(24-13-5-1-6-14-24)38(33,37(39)45)26-17-9-3-10-18-26/h1-23,33-34H/t33-,34+,38-,39-/m1/s1 |
| InChIKey | DCWVYNINOMSNGW-UDKDVIIMSA-N |
| XLogP | 7.55 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.54 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|