C39H23Cl3N2O5 — CID 99695147
(1S,2S,6S,7S)-4-(2-chloro-5-nitrophenyl)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 99695147) has the molecular formula C39H23Cl3N2O5 and a molecular weight of 705.98 g/mol. Its IUPAC name is (1S,2S,6S,7S)-4-(2-chloro-5-nitrophenyl)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1S,2S,6S,7S)-4-(2-chloro-5-nitrophenyl)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 99695147 |
| Molecular Formula | C39H23Cl3N2O5 |
| Molecular Weight | 705.98 g/mol |
| Exact Mass | 704.07 |
| IUPAC Name | (1S,2S,6S,7S)-4-(2-chloro-5-nitrophenyl)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1c1cc([N+](=O)[O-])ccc1Cl)[C@@]1(c3ccc(Cl)cc3)C(=O)[C@@]2(c2ccc(Cl)cc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C39H23Cl3N2O5/c40-26-15-11-24(12-16-26)38-31(22-7-3-1-4-8-22)32(23-9-5-2-6-10-23)39(37(38)47,25-13-17-27(41)18-14-25)34-33(38)35(45)43(36(34)46)30-21-28(44(48)49)19-20-29(30)42/h1-21,33-34H/t33-,34-,38+,39+/m1/s1 |
| InChIKey | AJPAWSLQFZNEDZ-AGSVCEGISA-N |
| XLogP | 8.74 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.98 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|