C45H29Cl2N3O3 — CID 126187253
(1S,2R,6R,7S)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-(4-phenyldiazenylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 126187253) has the molecular formula C45H29Cl2N3O3 and a molecular weight of 730.65 g/mol. Its IUPAC name is (1S,2R,6R,7S)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-(4-phenyldiazenylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1S,2R,6R,7S)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-(4-phenyldiazenylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 126187253 |
| Molecular Formula | C45H29Cl2N3O3 |
| Molecular Weight | 730.65 g/mol |
| Exact Mass | 729.16 |
| IUPAC Name | (1S,2R,6R,7S)-1,7-bis(4-chlorophenyl)-8,9-diphenyl-4-(4-phenyldiazenylphenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccc(/N=N/c3ccccc3)cc1)[C@@]1(c3ccc(Cl)cc3)C(=O)[C@@]2(c2ccc(Cl)cc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C45H29Cl2N3O3/c46-32-20-16-30(17-21-32)44-37(28-10-4-1-5-11-28)38(29-12-6-2-7-13-29)45(43(44)53,31-18-22-33(47)23-19-31)40-39(44)41(51)50(42(40)52)36-26-24-35(25-27-36)49-48-34-14-8-3-9-15-34/h1-27,39-40H/b49-48+/t39-,40-,44-,45-/m0/s1 |
| InChIKey | XGPFJEOBQHXFBU-ZSKCCABSSA-N |
| XLogP | 10.60 |
| TPSA | 79.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.65 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|