C39H26FNO3 — CID 99721429
(1S,2R,6R,7S)-4-(4-fluorophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 99721429) has the molecular formula C39H26FNO3 and a molecular weight of 575.64 g/mol. Its IUPAC name is (1S,2R,6R,7S)-4-(4-fluorophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1S,2R,6R,7S)-4-(4-fluorophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 99721429 |
| Molecular Formula | C39H26FNO3 |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | (1S,2R,6R,7S)-4-(4-fluorophenyl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccc(F)cc1)[C@@]1(c3ccccc3)C(=O)[C@@]2(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C39H26FNO3/c40-29-21-23-30(24-22-29)41-35(42)33-34(36(41)43)39(28-19-11-4-12-20-28)32(26-15-7-2-8-16-26)31(25-13-5-1-6-14-25)38(33,37(39)44)27-17-9-3-10-18-27/h1-24,33-34H/t33-,34-,38-,39-/m0/s1 |
| InChIKey | PJMCXTRTCSZIJM-VVHYXOSJSA-N |
| XLogP | 7.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|