C40H27NO5 — CID 98070544
(1R,2S,6S,7R)-4-(1,3-benzodioxol-5-yl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione (PubChem CID 98070544) has the molecular formula C40H27NO5 and a molecular weight of 601.66 g/mol. Its IUPAC name is (1R,2S,6S,7R)-4-(1,3-benzodioxol-5-yl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione.
| Compound Name | (1R,2S,6S,7R)-4-(1,3-benzodioxol-5-yl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
|---|---|
| PubChem CID | 98070544 |
| Molecular Formula | C40H27NO5 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | (1R,2S,6S,7R)-4-(1,3-benzodioxol-5-yl)-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5,10-trione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1c1ccc3c(c1)OCO3)[C@]1(c3ccccc3)C(=O)[C@]2(c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C40H27NO5/c42-36-34-35(37(43)41(36)29-21-22-30-31(23-29)46-24-45-30)40(28-19-11-4-12-20-28)33(26-15-7-2-8-16-26)32(25-13-5-1-6-14-25)39(34,38(40)44)27-17-9-3-10-18-27/h1-23,34-35H,24H2/t34-,35-,39-,40-/m1/s1 |
| InChIKey | OAAYMUQKYATBBQ-IBALQWCTSA-N |
| XLogP | 6.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|