C42H27NO9 — CID 99652717
4-[(1S,2R,6R,7S)-8,9-bis(1,3-benzodioxol-5-yl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid (PubChem CID 99652717) has the molecular formula C42H27NO9 and a molecular weight of 689.68 g/mol. Its IUPAC name is 4-[(1S,2R,6R,7S)-8,9-bis(1,3-benzodioxol-5-yl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid.
| Compound Name | 4-[(1S,2R,6R,7S)-8,9-bis(1,3-benzodioxol-5-yl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid |
|---|---|
| PubChem CID | 99652717 |
| Molecular Formula | C42H27NO9 |
| Molecular Weight | 689.68 g/mol |
| Exact Mass | 689.17 |
| IUPAC Name | 4-[(1S,2R,6R,7S)-8,9-bis(1,3-benzodioxol-5-yl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@]2(c4ccccc4)C(=O)[C@@]3(c3ccccc3)C(c3ccc4c(c3)OCO4)=C2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C42H27NO9/c44-37-35-36(38(45)43(37)28-15-11-23(12-16-28)39(46)47)42(27-9-5-2-6-10-27)34(25-14-18-30-32(20-25)52-22-50-30)33(24-13-17-29-31(19-24)51-21-49-29)41(35,40(42)48)26-7-3-1-4-8-26/h1-20,35-36H,21-22H2,(H,46,47)/t35-,36-,41-,42-/m0/s1 |
| InChIKey | OKVXQJRRRSILSR-YXRKCGNLSA-N |
| XLogP | 6.03 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|