C43H33NO5 — CID 124908805
[4-[(1S,2S,6S,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] acetate (PubChem CID 124908805) has the molecular formula C43H33NO5 and a molecular weight of 643.74 g/mol. Its IUPAC name is [4-[(1S,2S,6S,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] acetate.
| Compound Name | [4-[(1S,2S,6S,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] acetate |
|---|---|
| PubChem CID | 124908805 |
| Molecular Formula | C43H33NO5 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.24 |
| IUPAC Name | [4-[(1S,2S,6S,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)[C@H]3[C@H](C2=O)[C@@]2(c4ccccc4)C(=O)[C@@]3(c3ccccc3)C(c3ccc(C)cc3)=C2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C43H33NO5/c1-26-14-18-29(19-15-26)35-36(30-20-16-27(2)17-21-30)43(32-12-8-5-9-13-32)38-37(42(35,41(43)48)31-10-6-4-7-11-31)39(46)44(40(38)47)33-22-24-34(25-23-33)49-28(3)45/h4-25,37-38H,1-3H3/t37-,38-,42+,43+/m1/s1 |
| InChIKey | UNMXTMPVDUPJAM-RCVOXKFNSA-N |
| XLogP | 7.42 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|