C44H34ClNO5 — CID 126049883
ethyl 5-[(1S,2S,6R,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-chlorobenzoate (PubChem CID 126049883) has the molecular formula C44H34ClNO5 and a molecular weight of 692.21 g/mol. Its IUPAC name is ethyl 5-[(1S,2S,6R,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-chlorobenzoate.
| Compound Name | ethyl 5-[(1S,2S,6R,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-chlorobenzoate |
|---|---|
| PubChem CID | 126049883 |
| Molecular Formula | C44H34ClNO5 |
| Molecular Weight | 692.21 g/mol |
| Exact Mass | 691.21 |
| IUPAC Name | ethyl 5-[(1S,2S,6R,7S)-8,9-bis(4-methylphenyl)-3,5,10-trioxo-1,7-diphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1cc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@]2(c4ccccc4)C(=O)[C@@]3(c3ccccc3)C(c3ccc(C)cc3)=C2c2ccc(C)cc2)ccc1Cl |
| InChI | InChI=1S/C44H34ClNO5/c1-4-51-41(49)33-25-32(23-24-34(33)45)46-39(47)37-38(40(46)48)44(31-13-9-6-10-14-31)36(29-21-17-27(3)18-22-29)35(28-19-15-26(2)16-20-28)43(37,42(44)50)30-11-7-5-8-12-30/h5-25,37-38H,4H2,1-3H3/t37-,38+,43-,44-/m0/s1 |
| InChIKey | QUWSEUHWHMODAK-TVOBBRRNSA-N |
| XLogP | 8.32 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.21 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|