C42H30ClNO5 — CID 126055145
ethyl 2-chloro-5-[(1S,2S,6R,7S)-3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 126055145) has the molecular formula C42H30ClNO5 and a molecular weight of 664.16 g/mol. Its IUPAC name is ethyl 2-chloro-5-[(1S,2S,6R,7S)-3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | ethyl 2-chloro-5-[(1S,2S,6R,7S)-3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 126055145 |
| Molecular Formula | C42H30ClNO5 |
| Molecular Weight | 664.16 g/mol |
| Exact Mass | 663.18 |
| IUPAC Name | ethyl 2-chloro-5-[(1S,2S,6R,7S)-3,5,10-trioxo-1,7,8,9-tetraphenyl-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | CCOC(=O)c1cc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@]2(c4ccccc4)C(=O)[C@@]3(c3ccccc3)C(c3ccccc3)=C2c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C42H30ClNO5/c1-2-49-39(47)31-25-30(23-24-32(31)43)44-37(45)35-36(38(44)46)42(29-21-13-6-14-22-29)34(27-17-9-4-10-18-27)33(26-15-7-3-8-16-26)41(35,40(42)48)28-19-11-5-12-20-28/h3-25,35-36H,2H2,1H3/t35-,36+,41-,42-/m0/s1 |
| InChIKey | SVOAVSGRKFAMQE-VHXKMEMCSA-N |
| XLogP | 7.71 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.16 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|