C15H5Cl7N2O4 — CID 5049596
1,7,8,9,10,10-hexachloro-4-(2-chloro-5-nitrophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 5049596) has the molecular formula C15H5Cl7N2O4 and a molecular weight of 525.39 g/mol. Its IUPAC name is 1,7,8,9,10,10-hexachloro-4-(2-chloro-5-nitrophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1,7,8,9,10,10-hexachloro-4-(2-chloro-5-nitrophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 5049596 |
| Molecular Formula | C15H5Cl7N2O4 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 521.81 |
| IUPAC Name | 1,7,8,9,10,10-hexachloro-4-(2-chloro-5-nitrophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C(C(=O)N1c1cc([N+](=O)[O-])ccc1Cl)C1(Cl)C(Cl)=C(Cl)C2(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C15H5Cl7N2O4/c16-5-2-1-4(24(27)28)3-6(5)23-11(25)7-8(12(23)26)14(20)10(18)9(17)13(7,19)15(14,21)22/h1-3,7-8H |
| InChIKey | YXIPCEKMQLVIJU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|