C17H13ClN2O4 — CID 99724788
(1R,2S,6S,7R,8S,10R)-4-(2-chloro-5-nitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 99724788) has the molecular formula C17H13ClN2O4 and a molecular weight of 344.75 g/mol. Its IUPAC name is (1R,2S,6S,7R,8S,10R)-4-(2-chloro-5-nitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1R,2S,6S,7R,8S,10R)-4-(2-chloro-5-nitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 99724788 |
| Molecular Formula | C17H13ClN2O4 |
| Molecular Weight | 344.75 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (1R,2S,6S,7R,8S,10R)-4-(2-chloro-5-nitrophenyl)-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1[C@H]2[C@@H]3C=C[C@H]([C@@H]4C[C@H]34)[C@@H]2C(=O)N1c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C17H13ClN2O4/c18-12-4-1-7(20(23)24)5-13(12)19-16(21)14-8-2-3-9(11-6-10(8)11)15(14)17(19)22/h1-5,8-11,14-15H,6H2/t8-,9-,10-,11+,14+,15+/m1/s1 |
| InChIKey | YEPKVCZGNVXKKG-STNJXGOFSA-N |
| XLogP | 2.81 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|